MONOETHYL GLUTARATE
Ethyl hydrogen glutarate
CAS: 1070-62-8
Molecular Formula: C7H12O4
MONOETHYL GLUTARATE - Names and Identifiers
| Name | Ethyl hydrogen glutarate |
| Synonyms | MONOETHYL GLUTARATE monoethyl pentanedioate MONOETHYL GLUTARIC ACID Ethyl hydrogen glutarate ETHYL HYDROGEN GLUTARATE 5-ethoxy-5-oxopentanoic acid 5-ethoxy-5-keto-valeric acid GLUTARIC ACID MONOETHYL ESTER Pentanedioic acid 1-ethyl ester Glutaric acid hydrogen 1-ethyl ester Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester |
| CAS | 1070-62-8 |
| EINECS | 213-977-5 |
| InChI | InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
MONOETHYL GLUTARATE - Physico-chemical Properties
| Molecular Formula | C7H12O4 |
| Molar Mass | 160.17 |
| Density | 1,11 g/cm3 |
| Melting Point | 7-8 °C |
| Boling Point | 118-120°C 1,5mm |
| Flash Point | 118-120°C/1.5mm |
| Vapor Presure | 0.00103mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| BRN | 1766397 |
| pKa | 4.63±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4365 |
MONOETHYL GLUTARATE - Risk and Safety
| Risk Codes | 36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
MONOETHYL GLUTARATE - Introduction
Ethyl hydrogen glutarate, chemical formula C5H8O4, is a colorless liquid. The following is a description of the properties, uses, methods and safety information of ethyl hydrogen glutarate:
Nature:
1. Appearance: colorless to yellowish liquid
2. density: 1.20 g/cm
3. Melting point:-30°C
4. Boiling point: 246-247°C
5. Solubility: Soluble in ethanol, ether and other organic solvents, slightly soluble in water
6. chemical properties: ethyl hydrogen glutarate has ester generality, can occur esterification reaction, hydrolysis reaction, etc.
Use:
1. ethyl acetate derivatives: ethyl hydrogen glutarate is a derivative of ethyl acetate, can be used as a softener, plasticizer, coating, resin and solvent raw materials.
2. Chemical experiments: Ethyl hydrogen glutarate can be used in organic synthesis reactions as a solvent, reagent and catalyst mediator.
Preparation Method:
Ethyl hydrogen glutarate is usually prepared by the reaction of maleic anhydride and ethanol. The reaction conditions are generally carried out in the presence of an acidic catalyst.
Safety Information:
1. toxicity: hydrogen ethyl glutarate on human inhalation, ingestion or contact with the skin have certain toxicity, should avoid prolonged exposure and direct contact.
2. irritant: hydrogen ethyl glutarate is irritating and may cause eye and respiratory irritation.
3. protective measures: use should wear appropriate protective measures, such as wearing masks, gloves and goggles, and ensure good ventilation.
4. storage: hydrogen ethyl glutarate should be stored in a cool, dry, well-ventilated place, away from fire and oxidant.
Nature:
1. Appearance: colorless to yellowish liquid
2. density: 1.20 g/cm
3. Melting point:-30°C
4. Boiling point: 246-247°C
5. Solubility: Soluble in ethanol, ether and other organic solvents, slightly soluble in water
6. chemical properties: ethyl hydrogen glutarate has ester generality, can occur esterification reaction, hydrolysis reaction, etc.
Use:
1. ethyl acetate derivatives: ethyl hydrogen glutarate is a derivative of ethyl acetate, can be used as a softener, plasticizer, coating, resin and solvent raw materials.
2. Chemical experiments: Ethyl hydrogen glutarate can be used in organic synthesis reactions as a solvent, reagent and catalyst mediator.
Preparation Method:
Ethyl hydrogen glutarate is usually prepared by the reaction of maleic anhydride and ethanol. The reaction conditions are generally carried out in the presence of an acidic catalyst.
Safety Information:
1. toxicity: hydrogen ethyl glutarate on human inhalation, ingestion or contact with the skin have certain toxicity, should avoid prolonged exposure and direct contact.
2. irritant: hydrogen ethyl glutarate is irritating and may cause eye and respiratory irritation.
3. protective measures: use should wear appropriate protective measures, such as wearing masks, gloves and goggles, and ensure good ventilation.
4. storage: hydrogen ethyl glutarate should be stored in a cool, dry, well-ventilated place, away from fire and oxidant.
Last Update：2024-04-10 22:29:15
Supplier List
Featured ProductsSpot supply
Product Name: Monoethyl Glutarate Visit Supplier Webpage Request for quotationCAS: 1070-62-8
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: 5-Ethoxy-5-oxopentanoicacid Request for quotationCAS: 1070-62-8
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: Monoethyl Glutarate Visit Supplier Webpage Request for quotationCAS: 1070-62-8
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Featured ProductsSpot supply
Product Name: Monoethyl Glutarate Visit Supplier Webpage Request for quotationCAS: 1070-62-8
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: 5-Ethoxy-5-oxopentanoicacid Request for quotationCAS: 1070-62-8
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: Monoethyl Glutarate Visit Supplier Webpage Request for quotationCAS: 1070-62-8
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
View History